cresomycin
0 sources
cresomycin
Summary
cresomycin is a type of chemical entity[1]. cresomycin has Wikipedia articles in 5 language editions, a strong signal of global cultural recognition.[2]
Key Facts
- cresomycin's instance of is recorded as type of chemical entity[3].
- cresomycin's canonical SMILES is recorded as CC1C=CCCSC2C(C(C(C(C1NC(=O)C3C4C(CC(CCO4)CC(C)C)CN3)O2)O)O)O[4].
- cresomycin's chemical formula is recorded as C₂₅H₄₂N₂O₆S[5].
- cresomycin is a type of chemical compound[6].
- cresomycin is used for antibiotic[7].
- cresomycin's isomeric SMILES is recorded as C[C@@H]1/C=C\CCS[C@@H]2C@@HOC@@HO">[8].
- cresomycin's mass is recorded as {'unit': 'Q483261', 'amount': '+498.2763580639999'}[9].
Why It Matters
cresomycin has Wikipedia articles in 5 language editions, a strong signal of global cultural recognition.[2]