coenzyme B
0 sources
coenzyme B
Summary
coenzyme B is a type of chemical entity[1]. It ranks in the top 6% of type_of_chemical_entity entities by monthly Wikipedia readership (34 views/month).[2]
Key Facts
- coenzyme B's instance of is recorded as type of chemical entity[3].
- coenzyme B's canonical SMILES is recorded as CC(C(C(=O)O)NC(=O)CCCCCCS)OP(=O)(O)O[4].
- coenzyme B's chemical formula is recorded as C₁₁H₂₂NO₇PS[5].
- coenzyme B is a type of chemical compound[6].
- coenzyme B is part of coenzyme B metabolic process[7].
- coenzyme B is part of coenzyme B biosynthetic process[8].
- coenzyme B's Commons category is recorded as Coenzyme B[9].
- coenzyme B's isomeric SMILES is recorded as CC@HOP(=O)(O)OC@HOP(=O)(O)O">[10].
- coenzyme B's mass is recorded as {'amount': '+343.08546'}[11].
- coenzyme B's subject has role is recorded as cofactor[12].
Why It Matters
coenzyme B ranks in the top 6% of type_of_chemical_entity entities by monthly Wikipedia readership (34 views/month).[2] It has Wikipedia articles in 8 language editions, a strong signal of global cultural recognition.[13] It is known by 15 alternative names across languages and contexts.[14]